C17H20N2O6 — CID 7648113
(3-cyano-4-imino-2-oxopentyl) 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 7648113) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 7648113 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H20N2O6/c1-10(19)12(8-18)13(20)9-25-16(21)7-11-5-14(22-2)17(24-4)15(6-11)23-3/h5-6,12,19H,7,9H2,1-4H3/b19-10+ |
| InChIKey | VTBQBIXAOKODGW-VXLYETTFSA-N |
| XLogP | 1.55 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|