C19H25FN2O4 — CID 7442541
(2-oxo-2-piperidin-1-ylethyl) (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate (PubChem CID 7442541) has the molecular formula C19H25FN2O4 and a molecular weight of 364.42 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7442541 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(F)cc1)C(=O)OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H25FN2O4/c1-13(2)17(21-18(24)14-6-8-15(20)9-7-14)19(25)26-12-16(23)22-10-4-3-5-11-22/h6-9,13,17H,3-5,10-12H2,1-2H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | QLRMAUQFGWFGKW-KRWDZBQOSA-N |
| XLogP | 2.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |