C20H27FN2O4 — CID 78780462
ethyl 1-[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]piperidine-4-carboxylate (PubChem CID 78780462) has the molecular formula C20H27FN2O4 and a molecular weight of 378.44 g/mol. Its IUPAC name is ethyl 1-[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 78780462 |
| Molecular Formula | C20H27FN2O4 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | ethyl 1-[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C(NC(=O)c2ccc(F)cc2)C(C)C)CC1 |
| InChI | InChI=1S/C20H27FN2O4/c1-4-27-20(26)15-9-11-23(12-10-15)19(25)17(13(2)3)22-18(24)14-5-7-16(21)8-6-14/h5-8,13,15,17H,4,9-12H2,1-3H3,(H,22,24) |
| InChIKey | DPISTOOJNDIMEU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |