C19H26FN3O3 — CID 55520284
1-[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]-N-methylpiperidine-4-carboxamide (PubChem CID 55520284) has the molecular formula C19H26FN3O3 and a molecular weight of 363.43 g/mol. Its IUPAC name is 1-[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55520284 |
| Molecular Formula | C19H26FN3O3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 1-[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(C(=O)C(NC(=O)c2ccc(F)cc2)C(C)C)CC1 |
| InChI | InChI=1S/C19H26FN3O3/c1-12(2)16(22-18(25)13-4-6-15(20)7-5-13)19(26)23-10-8-14(9-11-23)17(24)21-3/h4-7,12,14,16H,8-11H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | JTECFYRSBHMYKY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |