C17H25ClFN3O2 — CID 119379031
N-[1-(3-aminopiperidin-1-yl)-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide;hydrochloride (PubChem CID 119379031) has the molecular formula C17H25ClFN3O2 and a molecular weight of 357.86 g/mol. Its IUPAC name is N-[1-(3-aminopiperidin-1-yl)-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide;hydrochloride.
| Compound Name | N-[1-(3-aminopiperidin-1-yl)-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119379031 |
| Molecular Formula | C17H25ClFN3O2 |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[1-(3-aminopiperidin-1-yl)-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide;hydrochloride |
| SMILES | CC(C)C(NC(=O)c1ccc(F)cc1)C(=O)N1CCCC(N)C1.Cl |
| InChI | InChI=1S/C17H24FN3O2.ClH/c1-11(2)15(17(23)21-9-3-4-14(19)10-21)20-16(22)12-5-7-13(18)8-6-12;/h5-8,11,14-15H,3-4,9-10,19H2,1-2H3,(H,20,22);1H |
| InChIKey | KQHBIMQHQNAOBP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |