C20H25FN2O4 — CID 119174706
6-[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid (PubChem CID 119174706) has the molecular formula C20H25FN2O4 and a molecular weight of 376.43 g/mol. Its IUPAC name is 6-[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid.
| Compound Name | 6-[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 119174706 |
| Molecular Formula | C20H25FN2O4 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 6-[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
| SMILES | CC(C)C(NC(=O)c1ccc(F)cc1)C(=O)N1CCC2(CC1)CC2C(=O)O |
| InChI | InChI=1S/C20H25FN2O4/c1-12(2)16(22-17(24)13-3-5-14(21)6-4-13)18(25)23-9-7-20(8-10-23)11-15(20)19(26)27/h3-6,12,15-16H,7-11H2,1-2H3,(H,22,24)(H,26,27) |
| InChIKey | ZRDJWWNTJWYUGW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |