C23H27FN2O3 — CID 8642678
[2-[1-adamantyl(2-cyanoethyl)amino]-2-oxoethyl] 2-(3-fluorophenyl)acetate (PubChem CID 8642678) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is [2-[1-adamantyl(2-cyanoethyl)amino]-2-oxoethyl] 2-(3-fluorophenyl)acetate.
| Compound Name | [2-[1-adamantyl(2-cyanoethyl)amino]-2-oxoethyl] 2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 8642678 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | [2-[1-adamantyl(2-cyanoethyl)amino]-2-oxoethyl] 2-(3-fluorophenyl)acetate |
| SMILES | N#CCCN(C(=O)COC(=O)Cc1cccc(F)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H27FN2O3/c24-20-4-1-3-16(10-20)11-22(28)29-15-21(27)26(6-2-5-25)23-12-17-7-18(13-23)9-19(8-17)14-23/h1,3-4,10,17-19H,2,6-9,11-15H2 |
| InChIKey | YJKCIMWSGBZAJI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |