C24H21BrN4O3 — CID 41475121
[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] (E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 41475121) has the molecular formula C24H21BrN4O3 and a molecular weight of 493.36 g/mol. Its IUPAC name is [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] (E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] (E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 41475121 |
| Molecular Formula | C24H21BrN4O3 |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] (E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | CN(CCC#N)C(=O)COC(=O)/C=C/c1cn(-c2ccccc2)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H21BrN4O3/c1-28(15-5-14-26)22(30)17-32-23(31)13-10-19-16-29(21-6-3-2-4-7-21)27-24(19)18-8-11-20(25)12-9-18/h2-4,6-13,16H,5,15,17H2,1H3/b13-10+ |
| InChIKey | RADIVXLIHLRDDL-JLHYYAGUSA-N |
| XLogP | 4.23 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|