C25H18BrClN4O3 — CID 16530976
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 16530976) has the molecular formula C25H18BrClN4O3 and a molecular weight of 537.80 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 16530976 |
| Molecular Formula | C25H18BrClN4O3 |
| Molecular Weight | 537.80 g/mol |
| Exact Mass | 536.03 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (E)-3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cn(-c2ccccc2)nc1-c1ccc(Br)cc1)Nc1cccnc1Cl |
| InChI | InChI=1S/C25H18BrClN4O3/c26-19-11-8-17(9-12-19)24-18(15-31(30-24)20-5-2-1-3-6-20)10-13-23(33)34-16-22(32)29-21-7-4-14-28-25(21)27/h1-15H,16H2,(H,29,32)/b13-10+ |
| InChIKey | MXCUKWSYBNVYFI-JLHYYAGUSA-N |
| XLogP | 5.55 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.80 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|