C30H26BrClN4O6S — CID 3559747
[2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 3559747) has the molecular formula C30H26BrClN4O6S and a molecular weight of 685.98 g/mol. Its IUPAC name is [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 3559747 |
| Molecular Formula | C30H26BrClN4O6S |
| Molecular Weight | 685.98 g/mol |
| Exact Mass | 684.04 |
| IUPAC Name | [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1cn(-c2ccccc2)nc1-c1ccc(Br)cc1)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C30H26BrClN4O6S/c31-23-9-6-21(7-10-23)30-22(19-36(34-30)24-4-2-1-3-5-24)8-13-29(38)42-20-28(37)33-27-18-25(11-12-26(27)32)43(39,40)35-14-16-41-17-15-35/h1-13,18-19H,14-17,20H2,(H,33,37) |
| InChIKey | KJHXMXATBPXNJY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.98 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|