C27H19N5O5 — CID 3511805
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] 3-(1,3-diphenylpyrazol-4-yl)prop-2-enoate (PubChem CID 3511805) has the molecular formula C27H19N5O5 and a molecular weight of 493.48 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 3-(1,3-diphenylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 3-(1,3-diphenylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3511805 |
| Molecular Formula | C27H19N5O5 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] 3-(1,3-diphenylpyrazol-4-yl)prop-2-enoate |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)C=Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H19N5O5/c28-16-21-15-23(32(35)36)12-13-24(21)29-25(33)18-37-26(34)14-11-20-17-31(22-9-5-2-6-10-22)30-27(20)19-7-3-1-4-8-19/h1-15,17H,18H2,(H,29,33) |
| InChIKey | DNACBEJRZJNKPU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|