C27H19ClN4O3 — CID 2435570
[2-(3-cyanoanilino)-2-oxoethyl] (E)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 2435570) has the molecular formula C27H19ClN4O3 and a molecular weight of 482.93 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] (E)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] (E)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2435570 |
| Molecular Formula | C27H19ClN4O3 |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] (E)-3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | N#Cc1cccc(NC(=O)COC(=O)/C=C/c2cn(-c3ccccc3)nc2-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C27H19ClN4O3/c28-22-12-9-20(10-13-22)27-21(17-32(31-27)24-7-2-1-3-8-24)11-14-26(34)35-18-25(33)30-23-6-4-5-19(15-23)16-29/h1-15,17H,18H2,(H,30,33)/b14-11+ |
| InChIKey | CKDSUFOSQHMBJS-SDNWHVSQSA-N |
| XLogP | 5.26 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|