C29H23FN4O3 — CID 2403586
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] (E)-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 2403586) has the molecular formula C29H23FN4O3 and a molecular weight of 494.53 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] (E)-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] (E)-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2403586 |
| Molecular Formula | C29H23FN4O3 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] (E)-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | N#CCCN(C(=O)COC(=O)/C=C/c1cn(-c2ccccc2)nc1-c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H23FN4O3/c30-24-15-12-22(13-16-24)29-23(20-34(32-29)26-10-5-2-6-11-26)14-17-28(36)37-21-27(35)33(19-7-18-31)25-8-3-1-4-9-25/h1-6,8-17,20H,7,19,21H2/b17-14+ |
| InChIKey | XGNDSOAQLQYGQI-SAPNQHFASA-N |
| XLogP | 5.18 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|