C27H22N4O3 — CID 4803119
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate (PubChem CID 4803119) has the molecular formula C27H22N4O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 4803119 |
| Molecular Formula | C27H22N4O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate |
| SMILES | N#CCCN(C(=O)COC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22N4O3/c28-17-10-18-30(22-13-6-2-7-14-22)25(32)20-34-27(33)24-19-31(23-15-8-3-9-16-23)29-26(24)21-11-4-1-5-12-21/h1-9,11-16,19H,10,18,20H2 |
| InChIKey | LGAUVBGCQBRKRE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |