C19H20N4O4 — CID 51109403
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] (E)-2-acetamido-3-phenylprop-2-enoate (PubChem CID 51109403) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] (E)-2-acetamido-3-phenylprop-2-enoate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] (E)-2-acetamido-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 51109403 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] (E)-2-acetamido-3-phenylprop-2-enoate |
| SMILES | CC(=O)N/C(=C/c1ccccc1)C(=O)OCC(=O)N(CCC#N)CCC#N |
| InChI | InChI=1S/C19H20N4O4/c1-15(24)22-17(13-16-7-3-2-4-8-16)19(26)27-14-18(25)23(11-5-9-20)12-6-10-21/h2-4,7-8,13H,5-6,11-12,14H2,1H3,(H,22,24)/b17-13+ |
| InChIKey | MUFGHBJWCLOGNV-GHRIWEEISA-N |
| XLogP | 1.36 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|