C24H21N3O4 — CID 55307454
[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] (E)-2-acetamido-3-phenylprop-2-enoate (PubChem CID 55307454) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] (E)-2-acetamido-3-phenylprop-2-enoate.
| Compound Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] (E)-2-acetamido-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 55307454 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] (E)-2-acetamido-3-phenylprop-2-enoate |
| SMILES | CC(=O)N/C(=C/c1ccccc1)C(=O)OCC(=O)c1cn(CCC#N)c2ccccc12 |
| InChI | InChI=1S/C24H21N3O4/c1-17(28)26-21(14-18-8-3-2-4-9-18)24(30)31-16-23(29)20-15-27(13-7-12-25)22-11-6-5-10-19(20)22/h2-6,8-11,14-15H,7,13,16H2,1H3,(H,26,28)/b21-14+ |
| InChIKey | XSNVQFNICSXSHN-KGENOOAVSA-N |
| XLogP | 3.46 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|