C22H20N2O3S — CID 55311106
[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 2-phenylsulfanylpropanoate (PubChem CID 55311106) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 2-phenylsulfanylpropanoate.
| Compound Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 55311106 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 2-phenylsulfanylpropanoate |
| SMILES | CC(Sc1ccccc1)C(=O)OCC(=O)c1cn(CCC#N)c2ccccc12 |
| InChI | InChI=1S/C22H20N2O3S/c1-16(28-17-8-3-2-4-9-17)22(26)27-15-21(25)19-14-24(13-7-12-23)20-11-6-5-10-18(19)20/h2-6,8-11,14,16H,7,13,15H2,1H3 |
| InChIKey | ZDUCURRFLJZTTF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |