C20H19N5O3 — CID 55999402
[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3-(pyrimidin-2-ylamino)propanoate (PubChem CID 55999402) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3-(pyrimidin-2-ylamino)propanoate.
| Compound Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3-(pyrimidin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 55999402 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3-(pyrimidin-2-ylamino)propanoate |
| SMILES | N#CCCn1cc(C(=O)COC(=O)CCNc2ncccn2)c2ccccc21 |
| InChI | InChI=1S/C20H19N5O3/c21-8-3-12-25-13-16(15-5-1-2-6-17(15)25)18(26)14-28-19(27)7-11-24-20-22-9-4-10-23-20/h1-2,4-6,9-10,13H,3,7,11-12,14H2,(H,22,23,24) |
| InChIKey | HOGBEJONPIVEDC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |