C20H15BrN2O3 — CID 7775299
[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 2-bromobenzoate (PubChem CID 7775299) has the molecular formula C20H15BrN2O3 and a molecular weight of 411.26 g/mol. Its IUPAC name is [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 2-bromobenzoate.
| Compound Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 7775299 |
| Molecular Formula | C20H15BrN2O3 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 2-bromobenzoate |
| SMILES | N#CCCn1cc(C(=O)COC(=O)c2ccccc2Br)c2ccccc21 |
| InChI | InChI=1S/C20H15BrN2O3/c21-17-8-3-1-7-15(17)20(25)26-13-19(24)16-12-23(11-5-10-22)18-9-4-2-6-14(16)18/h1-4,6-9,12H,5,11,13H2 |
| InChIKey | PLUFGBPFNXJILO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |