C20H14F2N2O3 — CID 55326130
[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3,5-difluorobenzoate (PubChem CID 55326130) has the molecular formula C20H14F2N2O3 and a molecular weight of 368.34 g/mol. Its IUPAC name is [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3,5-difluorobenzoate.
| Compound Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3,5-difluorobenzoate |
|---|---|
| PubChem CID | 55326130 |
| Molecular Formula | C20H14F2N2O3 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3,5-difluorobenzoate |
| SMILES | N#CCCn1cc(C(=O)COC(=O)c2cc(F)cc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C20H14F2N2O3/c21-14-8-13(9-15(22)10-14)20(26)27-12-19(25)17-11-24(7-3-6-23)18-5-2-1-4-16(17)18/h1-2,4-5,8-11H,3,7,12H2 |
| InChIKey | PRJUCQWASVTOHP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |