C22H19N3O4 — CID 7654135
[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 4-acetamidobenzoate (PubChem CID 7654135) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 4-acetamidobenzoate.
| Compound Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 7654135 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCC(=O)c2cn(CCC#N)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H19N3O4/c1-15(26)24-17-9-7-16(8-10-17)22(28)29-14-21(27)19-13-25(12-4-11-23)20-6-3-2-5-18(19)20/h2-3,5-10,13H,4,12,14H2,1H3,(H,24,26) |
| InChIKey | WFVMTKSLRMJMBK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |