C22H19ClN2O5 — CID 55310483
[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate (PubChem CID 55310483) has the molecular formula C22H19ClN2O5 and a molecular weight of 426.86 g/mol. Its IUPAC name is [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate.
| Compound Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 55310483 |
| Molecular Formula | C22H19ClN2O5 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)c2cn(CCC#N)c3ccccc23)cc(Cl)c1OC |
| InChI | InChI=1S/C22H19ClN2O5/c1-28-20-11-14(10-17(23)21(20)29-2)22(27)30-13-19(26)16-12-25(9-5-8-24)18-7-4-3-6-15(16)18/h3-4,6-7,10-12H,5,9,13H2,1-2H3 |
| InChIKey | WXUWGLSBXJNRIC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 90.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |