C20H15N3O5 — CID 7866080
[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3-nitrobenzoate (PubChem CID 7866080) has the molecular formula C20H15N3O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3-nitrobenzoate.
| Compound Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 7866080 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 3-nitrobenzoate |
| SMILES | N#CCCn1cc(C(=O)COC(=O)c2cccc([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C20H15N3O5/c21-9-4-10-22-12-17(16-7-1-2-8-18(16)22)19(24)13-28-20(25)14-5-3-6-15(11-14)23(26)27/h1-3,5-8,11-12H,4,10,13H2 |
| InChIKey | IOPXSKRHGGTQKZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 115.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|