C22H20N2O3 — CID 8534925
[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 2,5-dimethylbenzoate (PubChem CID 8534925) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 2,5-dimethylbenzoate.
| Compound Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 8534925 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 2,5-dimethylbenzoate |
| SMILES | Cc1ccc(C)c(C(=O)OCC(=O)c2cn(CCC#N)c3ccccc23)c1 |
| InChI | InChI=1S/C22H20N2O3/c1-15-8-9-16(2)18(12-15)22(26)27-14-21(25)19-13-24(11-5-10-23)20-7-4-3-6-17(19)20/h3-4,6-9,12-13H,5,11,14H2,1-2H3 |
| InChIKey | PYMLQFVOZLMRQW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |