C23H21N3O6 — CID 55426101
[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 4-(2-amino-2-oxoethoxy)-3-methoxybenzoate (PubChem CID 55426101) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 4-(2-amino-2-oxoethoxy)-3-methoxybenzoate.
| Compound Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 4-(2-amino-2-oxoethoxy)-3-methoxybenzoate |
|---|---|
| PubChem CID | 55426101 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | [2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl] 4-(2-amino-2-oxoethoxy)-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)c2cn(CCC#N)c3ccccc23)ccc1OCC(N)=O |
| InChI | InChI=1S/C23H21N3O6/c1-30-21-11-15(7-8-20(21)31-14-22(25)28)23(29)32-13-19(27)17-12-26(10-4-9-24)18-6-3-2-5-16(17)18/h2-3,5-8,11-12H,4,10,13-14H2,1H3,(H2,25,28) |
| InChIKey | WSGJWIKTWBAUIZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |