C16H16FN3O2 — CID 103598565
N,N-bis(2-cyanoethyl)-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide (PubChem CID 103598565) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide.
| Compound Name | N,N-bis(2-cyanoethyl)-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 103598565 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)N(CCC#N)CCC#N)cc1F |
| InChI | InChI=1S/C16H16FN3O2/c1-22-15-6-4-13(12-14(15)17)5-7-16(21)20(10-2-8-18)11-3-9-19/h4-7,12H,2-3,10-11H2,1H3 |
| InChIKey | YPXSLKLOABNBEJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|