C16H20N2O3 — CID 75616904
3-[4-(cyanomethoxy)-3-methoxyphenyl]-N,N-diethylprop-2-enamide (PubChem CID 75616904) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-[4-(cyanomethoxy)-3-methoxyphenyl]-N,N-diethylprop-2-enamide.
| Compound Name | 3-[4-(cyanomethoxy)-3-methoxyphenyl]-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 75616904 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-[4-(cyanomethoxy)-3-methoxyphenyl]-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)C=Cc1ccc(OCC#N)c(OC)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-4-18(5-2)16(19)9-7-13-6-8-14(21-11-10-17)15(12-13)20-3/h6-9,12H,4-5,11H2,1-3H3 |
| InChIKey | XYNITHXEKLSALO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|