C18H21N3O3 — CID 97435242
(Z)-N,N-bis(2-cyanoethyl)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enamide (PubChem CID 97435242) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (Z)-N,N-bis(2-cyanoethyl)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-N,N-bis(2-cyanoethyl)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 97435242 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (Z)-N,N-bis(2-cyanoethyl)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C\C(=O)N(CCC#N)CCC#N)ccc1OC |
| InChI | InChI=1S/C18H21N3O3/c1-3-24-17-14-15(6-8-16(17)23-2)7-9-18(22)21(12-4-10-19)13-5-11-20/h6-9,14H,3-5,12-13H2,1-2H3/b9-7- |
| InChIKey | OGNARYNOQWPJPU-CLFYSBASSA-N |
| XLogP | 2.76 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|