C18H21N3O3 — CID 78767174
N,N-bis(2-cyanoethyl)-2-(2-methoxy-4-prop-1-enylphenoxy)acetamide (PubChem CID 78767174) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-(2-methoxy-4-prop-1-enylphenoxy)acetamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-(2-methoxy-4-prop-1-enylphenoxy)acetamide |
|---|---|
| PubChem CID | 78767174 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-(2-methoxy-4-prop-1-enylphenoxy)acetamide |
| SMILES | CC=Cc1ccc(OCC(=O)N(CCC#N)CCC#N)c(OC)c1 |
| InChI | InChI=1S/C18H21N3O3/c1-3-6-15-7-8-16(17(13-15)23-2)24-14-18(22)21(11-4-9-19)12-5-10-20/h3,6-8,13H,4-5,11-12,14H2,1-2H3 |
| InChIKey | NMMPOGWHRYKHRP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |