C17H22N2O3 — CID 78805506
N-(2-cyanoethyl)-3-(3,4-diethoxyphenyl)-N-methylprop-2-enamide (PubChem CID 78805506) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-(3,4-diethoxyphenyl)-N-methylprop-2-enamide.
| Compound Name | N-(2-cyanoethyl)-3-(3,4-diethoxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 78805506 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-(2-cyanoethyl)-3-(3,4-diethoxyphenyl)-N-methylprop-2-enamide |
| SMILES | CCOc1ccc(C=CC(=O)N(C)CCC#N)cc1OCC |
| InChI | InChI=1S/C17H22N2O3/c1-4-21-15-9-7-14(13-16(15)22-5-2)8-10-17(20)19(3)12-6-11-18/h7-10,13H,4-6,12H2,1-3H3 |
| InChIKey | AZUOEGMXDGBYPQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|