C17H25ClNO3- — CID 21228695
(E)-1-(3,4-diethoxyphenyl)-5-(dimethylamino)pent-1-en-3-one chloride (PubChem CID 21228695) has the molecular formula C17H25ClNO3- and a molecular weight of 326.84 g/mol. Its IUPAC name is (E)-1-(3,4-diethoxyphenyl)-5-(dimethylamino)pent-1-en-3-one chloride.
| Compound Name | (E)-1-(3,4-diethoxyphenyl)-5-(dimethylamino)pent-1-en-3-one chloride |
|---|---|
| PubChem CID | 21228695 |
| Molecular Formula | C17H25ClNO3- |
| Molecular Weight | 326.84 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (E)-1-(3,4-diethoxyphenyl)-5-(dimethylamino)pent-1-en-3-one chloride |
| SMILES | CCOc1ccc(/C=C/C(=O)CCN(C)C)cc1OCC.[Cl-] |
| InChI | InChI=1S/C17H25NO3.ClH/c1-5-20-16-10-8-14(13-17(16)21-6-2)7-9-15(19)11-12-18(3)4;/h7-10,13H,5-6,11-12H2,1-4H3;1H/p-1/b9-7+; |
| InChIKey | PCQQFBBMDBVIGP-BXTVWIJMSA-M |
| XLogP | 0.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.84 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|