C23H28FNO4 — CID 35605636
(E)-3-(3,4-diethoxyphenyl)-N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 35605636) has the molecular formula C23H28FNO4 and a molecular weight of 401.48 g/mol. Its IUPAC name is (E)-3-(3,4-diethoxyphenyl)-N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-diethoxyphenyl)-N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 35605636 |
| Molecular Formula | C23H28FNO4 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (E)-3-(3,4-diethoxyphenyl)-N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)N(CC)Cc2ccc(OC)c(F)c2)cc1OCC |
| InChI | InChI=1S/C23H28FNO4/c1-5-25(16-18-9-11-20(27-4)19(24)14-18)23(26)13-10-17-8-12-21(28-6-2)22(15-17)29-7-3/h8-15H,5-7,16H2,1-4H3/b13-10+ |
| InChIKey | UFKPEVQHQKUXJH-JLHYYAGUSA-N |
| XLogP | 4.69 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|