C13H15ClFNO — CID 97305606
(Z)-3-(3-chloro-4-fluorophenyl)-N,N-diethylprop-2-enamide (PubChem CID 97305606) has the molecular formula C13H15ClFNO and a molecular weight of 255.72 g/mol. Its IUPAC name is (Z)-3-(3-chloro-4-fluorophenyl)-N,N-diethylprop-2-enamide.
| Compound Name | (Z)-3-(3-chloro-4-fluorophenyl)-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 97305606 |
| Molecular Formula | C13H15ClFNO |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (Z)-3-(3-chloro-4-fluorophenyl)-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C\c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClFNO/c1-3-16(4-2)13(17)8-6-10-5-7-12(15)11(14)9-10/h5-9H,3-4H2,1-2H3/b8-6- |
| InChIKey | BNGAVDRXGPXEIQ-VURMDHGXSA-N |
| XLogP | 3.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|