C13H18N2O — CID 39243869
(E)-3-(3-aminophenyl)-N,N-diethylprop-2-enamide (PubChem CID 39243869) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is (E)-3-(3-aminophenyl)-N,N-diethylprop-2-enamide.
| Compound Name | (E)-3-(3-aminophenyl)-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 39243869 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (E)-3-(3-aminophenyl)-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C/c1cccc(N)c1 |
| InChI | InChI=1S/C13H18N2O/c1-3-15(4-2)13(16)9-8-11-6-5-7-12(14)10-11/h5-10H,3-4,14H2,1-2H3/b9-8+ |
| InChIKey | QOYNVGIXRBHCBC-CMDGGOBGSA-N |
| XLogP | 2.15 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|