C15H15Cl2NO — CID 895970
3-(3,4-dichlorophenyl)-N,N-bis(prop-2-enyl)prop-2-enamide (PubChem CID 895970) has the molecular formula C15H15Cl2NO and a molecular weight of 296.20 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N,N-bis(prop-2-enyl)prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N,N-bis(prop-2-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 895970 |
| Molecular Formula | C15H15Cl2NO |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N,N-bis(prop-2-enyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)C=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H15Cl2NO/c1-3-9-18(10-4-2)15(19)8-6-12-5-7-13(16)14(17)11-12/h3-8,11H,1-2,9-10H2 |
| InChIKey | JAASDZSPYXYETA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|