C14H13Cl2NO3 — CID 79263049
2-[3-(3,4-dichlorophenyl)prop-2-enoyl-prop-2-enylamino]acetic acid (PubChem CID 79263049) has the molecular formula C14H13Cl2NO3 and a molecular weight of 314.17 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)prop-2-enoyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[3-(3,4-dichlorophenyl)prop-2-enoyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79263049 |
| Molecular Formula | C14H13Cl2NO3 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)prop-2-enoyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)C=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2NO3/c1-2-7-17(9-14(19)20)13(18)6-4-10-3-5-11(15)12(16)8-10/h2-6,8H,1,7,9H2,(H,19,20) |
| InChIKey | XWWUKIABEPCDHA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|