C13H13NO6 — CID 77003605
2-[carboxymethyl-[3-(4-hydroxyphenyl)prop-2-enoyl]amino]acetic acid (PubChem CID 77003605) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is 2-[carboxymethyl-[3-(4-hydroxyphenyl)prop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[3-(4-hydroxyphenyl)prop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 77003605 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-[carboxymethyl-[3-(4-hydroxyphenyl)prop-2-enoyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(=O)C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H13NO6/c15-10-4-1-9(2-5-10)3-6-11(16)14(7-12(17)18)8-13(19)20/h1-6,15H,7-8H2,(H,17,18)(H,19,20) |
| InChIKey | JIRXQNPQXVMLDL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|