C23H25ClF3N3O2 — CID 55488088
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(3-morpholin-4-ylpropyl)-N-(pyridin-4-ylmethyl)prop-2-enamide (PubChem CID 55488088) has the molecular formula C23H25ClF3N3O2 and a molecular weight of 467.92 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(3-morpholin-4-ylpropyl)-N-(pyridin-4-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(3-morpholin-4-ylpropyl)-N-(pyridin-4-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 55488088 |
| Molecular Formula | C23H25ClF3N3O2 |
| Molecular Weight | 467.92 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(3-morpholin-4-ylpropyl)-N-(pyridin-4-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(C(F)(F)F)c1)N(CCCN1CCOCC1)Cc1ccncc1 |
| InChI | InChI=1S/C23H25ClF3N3O2/c24-21-4-2-18(16-20(21)23(25,26)27)3-5-22(31)30(17-19-6-8-28-9-7-19)11-1-10-29-12-14-32-15-13-29/h2-9,16H,1,10-15,17H2/b5-3+ |
| InChIKey | VCEKGTFICVPGDX-HWKANZROSA-N |
| XLogP | 4.52 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.92 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|