C28H31N3O2 — CID 56564244
(E)-N-(3-morpholin-4-ylpropyl)-3-(3-phenylphenyl)-N-(pyridin-4-ylmethyl)prop-2-enamide (PubChem CID 56564244) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is (E)-N-(3-morpholin-4-ylpropyl)-3-(3-phenylphenyl)-N-(pyridin-4-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-(3-morpholin-4-ylpropyl)-3-(3-phenylphenyl)-N-(pyridin-4-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 56564244 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (E)-N-(3-morpholin-4-ylpropyl)-3-(3-phenylphenyl)-N-(pyridin-4-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(-c2ccccc2)c1)N(CCCN1CCOCC1)Cc1ccncc1 |
| InChI | InChI=1S/C28H31N3O2/c32-28(11-10-24-6-4-9-27(22-24)26-7-2-1-3-8-26)31(23-25-12-14-29-15-13-25)17-5-16-30-18-20-33-21-19-30/h1-4,6-15,22H,5,16-21,23H2/b11-10+ |
| InChIKey | CIICZHTWFBPWEN-ZHACJKMWSA-N |
| XLogP | 4.51 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|