C21H16ClF3N2O2 — CID 75868911
3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(furan-2-ylmethyl)-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 75868911) has the molecular formula C21H16ClF3N2O2 and a molecular weight of 420.82 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(furan-2-ylmethyl)-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(furan-2-ylmethyl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 75868911 |
| Molecular Formula | C21H16ClF3N2O2 |
| Molecular Weight | 420.82 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(furan-2-ylmethyl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(C(F)(F)F)c1)N(Cc1cccnc1)Cc1ccco1 |
| InChI | InChI=1S/C21H16ClF3N2O2/c22-19-7-5-15(11-18(19)21(23,24)25)6-8-20(28)27(14-17-4-2-10-29-17)13-16-3-1-9-26-12-16/h1-12H,13-14H2 |
| InChIKey | HMJBUZIOCNCEBG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.82 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|