C21H17Cl2NO2 — CID 18830822
(E)-N-benzyl-3-(2,4-dichlorophenyl)-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 18830822) has the molecular formula C21H17Cl2NO2 and a molecular weight of 386.28 g/mol. Its IUPAC name is (E)-N-benzyl-3-(2,4-dichlorophenyl)-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-benzyl-3-(2,4-dichlorophenyl)-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 18830822 |
| Molecular Formula | C21H17Cl2NO2 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | (E)-N-benzyl-3-(2,4-dichlorophenyl)-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C21H17Cl2NO2/c22-18-10-8-17(20(23)13-18)9-11-21(25)24(15-19-7-4-12-26-19)14-16-5-2-1-3-6-16/h1-13H,14-15H2/b11-9+ |
| InChIKey | CRAIHSLCPBZCDX-PKNBQFBNSA-N |
| XLogP | 5.83 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|