C21H17F4NO5 — CID 55360216
(E)-3-[2,4-bis(difluoromethoxy)phenyl]-N,N-bis(furan-2-ylmethyl)prop-2-enamide (PubChem CID 55360216) has the molecular formula C21H17F4NO5 and a molecular weight of 439.36 g/mol. Its IUPAC name is (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N,N-bis(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N,N-bis(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 55360216 |
| Molecular Formula | C21H17F4NO5 |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N,N-bis(furan-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1OC(F)F)N(Cc1ccco1)Cc1ccco1 |
| InChI | InChI=1S/C21H17F4NO5/c22-20(23)30-15-7-5-14(18(11-15)31-21(24)25)6-8-19(27)26(12-16-3-1-9-28-16)13-17-4-2-10-29-17/h1-11,20-21H,12-13H2/b8-6+ |
| InChIKey | QNQPFWBLYFLJTG-SOFGYWHQSA-N |
| XLogP | 5.32 |
| TPSA | 65.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|