C20H25NO3 — CID 60553181
(E)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)-3-(2,4,5-trimethylphenyl)prop-2-enamide (PubChem CID 60553181) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (E)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)-3-(2,4,5-trimethylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)-3-(2,4,5-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 60553181 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (E)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)-3-(2,4,5-trimethylphenyl)prop-2-enamide |
| SMILES | COCCN(Cc1ccco1)C(=O)/C=C/c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C20H25NO3/c1-15-12-17(3)18(13-16(15)2)7-8-20(22)21(9-11-23-4)14-19-6-5-10-24-19/h5-8,10,12-13H,9,11,14H2,1-4H3/b8-7+ |
| InChIKey | ZRTYAGGACRQQEP-BQYQJAHWSA-N |
| XLogP | 3.89 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|