C18H21NO2 — CID 55686707
(E)-N-[2-(furan-2-yl)ethyl]-3-(2,4,5-trimethylphenyl)prop-2-enamide (PubChem CID 55686707) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (E)-N-[2-(furan-2-yl)ethyl]-3-(2,4,5-trimethylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(furan-2-yl)ethyl]-3-(2,4,5-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55686707 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (E)-N-[2-(furan-2-yl)ethyl]-3-(2,4,5-trimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c(/C=C/C(=O)NCCc2ccco2)cc1C |
| InChI | InChI=1S/C18H21NO2/c1-13-11-15(3)16(12-14(13)2)6-7-18(20)19-9-8-17-5-4-10-21-17/h4-7,10-12H,8-9H2,1-3H3,(H,19,20)/b7-6+ |
| InChIKey | JLHMJJAMXFCXSD-VOTSOKGWSA-N |
| XLogP | 3.58 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|