C20H19NO3 — CID 9184707
(E)-N-[2-(furan-2-yl)ethyl]-3-(6-methoxynaphthalen-2-yl)prop-2-enamide (PubChem CID 9184707) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (E)-N-[2-(furan-2-yl)ethyl]-3-(6-methoxynaphthalen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(furan-2-yl)ethyl]-3-(6-methoxynaphthalen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9184707 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (E)-N-[2-(furan-2-yl)ethyl]-3-(6-methoxynaphthalen-2-yl)prop-2-enamide |
| SMILES | COc1ccc2cc(/C=C/C(=O)NCCc3ccco3)ccc2c1 |
| InChI | InChI=1S/C20H19NO3/c1-23-19-8-7-16-13-15(4-6-17(16)14-19)5-9-20(22)21-11-10-18-3-2-12-24-18/h2-9,12-14H,10-11H2,1H3,(H,21,22)/b9-5+ |
| InChIKey | RCWMGARCFUBKMO-WEVVVXLNSA-N |
| XLogP | 3.81 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|