C11H12N2O5 — CID 54954888
4-[2-(furan-2-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 54954888) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is 4-[2-(furan-2-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[2-(furan-2-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54954888 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 4-[2-(furan-2-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NC(=O)NCCc1ccco1 |
| InChI | InChI=1S/C11H12N2O5/c14-9(3-4-10(15)16)13-11(17)12-6-5-8-2-1-7-18-8/h1-4,7H,5-6H2,(H,15,16)(H2,12,13,14,17) |
| InChIKey | CVQJZJNYJJPJKX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|