C16H16ClN3O3S — CID 32993456
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)prop-2-enamide (PubChem CID 32993456) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 32993456 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)prop-2-enamide |
| SMILES | COCCN(Cc1ccco1)C(=O)/C=C/c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C16H16ClN3O3S/c1-22-9-6-19(11-12-3-2-8-23-12)14(21)5-4-13-15(17)18-16-20(13)7-10-24-16/h2-5,7-8,10H,6,9,11H2,1H3/b5-4+ |
| InChIKey | MKOZVFAGJIAJKW-SNAWJCMRSA-N |
| XLogP | 3.33 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|