C19H21F4N3O3 — CID 94636665
(E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[(1-methylpyrazol-4-yl)methyl]-N-propan-2-ylprop-2-enamide (PubChem CID 94636665) has the molecular formula C19H21F4N3O3 and a molecular weight of 415.39 g/mol. Its IUPAC name is (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[(1-methylpyrazol-4-yl)methyl]-N-propan-2-ylprop-2-enamide.
| Compound Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[(1-methylpyrazol-4-yl)methyl]-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 94636665 |
| Molecular Formula | C19H21F4N3O3 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[(1-methylpyrazol-4-yl)methyl]-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)N(Cc1cnn(C)c1)C(=O)/C=C/c1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C19H21F4N3O3/c1-12(2)26(11-13-9-24-25(3)10-13)17(27)7-5-14-4-6-15(28-18(20)21)8-16(14)29-19(22)23/h4-10,12,18-19H,11H2,1-3H3/b7-5+ |
| InChIKey | DIDUVPJHHCMQAT-FNORWQNLSA-N |
| XLogP | 4.07 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|