C23H22ClNO4 — CID 34907243
(E)-N-benzyl-3-(3-chloro-4,5-dimethoxyphenyl)-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 34907243) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is (E)-N-benzyl-3-(3-chloro-4,5-dimethoxyphenyl)-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-benzyl-3-(3-chloro-4,5-dimethoxyphenyl)-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 34907243 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (E)-N-benzyl-3-(3-chloro-4,5-dimethoxyphenyl)-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(Cc2ccccc2)Cc2ccco2)cc(Cl)c1OC |
| InChI | InChI=1S/C23H22ClNO4/c1-27-21-14-18(13-20(24)23(21)28-2)10-11-22(26)25(16-19-9-6-12-29-19)15-17-7-4-3-5-8-17/h3-14H,15-16H2,1-2H3/b11-10+ |
| InChIKey | OTQYTHKYCJHKGC-ZHACJKMWSA-N |
| XLogP | 5.19 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|