C21H19NO2 — CID 790450
(E)-N,N-dibenzyl-3-(furan-2-yl)prop-2-enamide (PubChem CID 790450) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (E)-N,N-dibenzyl-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N,N-dibenzyl-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 790450 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (E)-N,N-dibenzyl-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H19NO2/c23-21(14-13-20-12-7-15-24-20)22(16-18-8-3-1-4-9-18)17-19-10-5-2-6-11-19/h1-15H,16-17H2/b14-13+ |
| InChIKey | YPJUEEYNRSPYJV-BUHFOSPRSA-N |
| XLogP | 4.52 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|